C19H19ClN2O3 — CID 44660205
ethyl 4-(4-hydroxyanilino)-2-methylquinolin-1-ium-6-carboxylate chloride (PubChem CID 44660205) has the molecular formula C19H19ClN2O3 and a molecular weight of 358.83 g/mol. Its IUPAC name is ethyl 4-(4-hydroxyanilino)-2-methylquinolin-1-ium-6-carboxylate chloride.
| Compound Name | ethyl 4-(4-hydroxyanilino)-2-methylquinolin-1-ium-6-carboxylate chloride |
|---|---|
| PubChem CID | 44660205 |
| Molecular Formula | C19H19ClN2O3 |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | ethyl 4-(4-hydroxyanilino)-2-methylquinolin-1-ium-6-carboxylate chloride |
| SMILES | CCOC(=O)c1ccc2[nH+]c(C)cc(Nc3ccc(O)cc3)c2c1.[Cl-] |
| InChI | InChI=1S/C19H18N2O3.ClH/c1-3-24-19(23)13-4-9-17-16(11-13)18(10-12(2)20-17)21-14-5-7-15(22)8-6-14;/h4-11,22H,3H2,1-2H3,(H,20,21);1H |
| InChIKey | FLIHINJAWTUANJ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|