C19H18Cl2N2O2 — CID 2919127
ethyl 4-(4-chloroanilino)-2-methylquinoline-6-carboxylate;hydrochloride (PubChem CID 2919127) has the molecular formula C19H18Cl2N2O2 and a molecular weight of 377.27 g/mol. Its IUPAC name is ethyl 4-(4-chloroanilino)-2-methylquinoline-6-carboxylate;hydrochloride.
| Compound Name | ethyl 4-(4-chloroanilino)-2-methylquinoline-6-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 2919127 |
| Molecular Formula | C19H18Cl2N2O2 |
| Molecular Weight | 377.27 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | ethyl 4-(4-chloroanilino)-2-methylquinoline-6-carboxylate;hydrochloride |
| SMILES | CCOC(=O)c1ccc2nc(C)cc(Nc3ccc(Cl)cc3)c2c1.Cl |
| InChI | InChI=1S/C19H17ClN2O2.ClH/c1-3-24-19(23)13-4-9-17-16(11-13)18(10-12(2)21-17)22-15-7-5-14(20)6-8-15;/h4-11H,3H2,1-2H3,(H,21,22);1H |
| InChIKey | AKXJJSWTTUUEOB-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.27 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |