C24H20Cl2N2O3 — CID 22694157
4-[4-[(4-chlorophenyl)methoxy]anilino]-2-methylquinoline-6-carboxylic acid;hydrochloride (PubChem CID 22694157) has the molecular formula C24H20Cl2N2O3 and a molecular weight of 455.34 g/mol. Its IUPAC name is 4-[4-[(4-chlorophenyl)methoxy]anilino]-2-methylquinoline-6-carboxylic acid;hydrochloride.
| Compound Name | 4-[4-[(4-chlorophenyl)methoxy]anilino]-2-methylquinoline-6-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 22694157 |
| Molecular Formula | C24H20Cl2N2O3 |
| Molecular Weight | 455.34 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | 4-[4-[(4-chlorophenyl)methoxy]anilino]-2-methylquinoline-6-carboxylic acid;hydrochloride |
| SMILES | Cc1cc(Nc2ccc(OCc3ccc(Cl)cc3)cc2)c2cc(C(=O)O)ccc2n1.Cl |
| InChI | InChI=1S/C24H19ClN2O3.ClH/c1-15-12-23(21-13-17(24(28)29)4-11-22(21)26-15)27-19-7-9-20(10-8-19)30-14-16-2-5-18(25)6-3-16;/h2-13H,14H2,1H3,(H,26,27)(H,28,29);1H |
| InChIKey | BZQFMXFUSWPDCZ-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.34 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |