C23H19Cl3N2O — CID 2790572
6-chloro-N-[4-[(2-chlorophenyl)methoxy]phenyl]-2-methylquinolin-4-amine;hydrochloride (PubChem CID 2790572) has the molecular formula C23H19Cl3N2O and a molecular weight of 445.78 g/mol. Its IUPAC name is 6-chloro-N-[4-[(2-chlorophenyl)methoxy]phenyl]-2-methylquinolin-4-amine;hydrochloride.
| Compound Name | 6-chloro-N-[4-[(2-chlorophenyl)methoxy]phenyl]-2-methylquinolin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 2790572 |
| Molecular Formula | C23H19Cl3N2O |
| Molecular Weight | 445.78 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | 6-chloro-N-[4-[(2-chlorophenyl)methoxy]phenyl]-2-methylquinolin-4-amine;hydrochloride |
| SMILES | Cc1cc(Nc2ccc(OCc3ccccc3Cl)cc2)c2cc(Cl)ccc2n1.Cl |
| InChI | InChI=1S/C23H18Cl2N2O.ClH/c1-15-12-23(20-13-17(24)6-11-22(20)26-15)27-18-7-9-19(10-8-18)28-14-16-4-2-3-5-21(16)25;/h2-13H,14H2,1H3,(H,26,27);1H |
| InChIKey | ZUSZDGNSWYSHKC-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.78 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |