C18H18ClFN2O — CID 56728858
6-ethoxy-N-(2-fluorophenyl)-2-methylquinolin-4-amine;hydrochloride (PubChem CID 56728858) has the molecular formula C18H18ClFN2O and a molecular weight of 332.81 g/mol. Its IUPAC name is 6-ethoxy-N-(2-fluorophenyl)-2-methylquinolin-4-amine;hydrochloride.
| Compound Name | 6-ethoxy-N-(2-fluorophenyl)-2-methylquinolin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 56728858 |
| Molecular Formula | C18H18ClFN2O |
| Molecular Weight | 332.81 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 6-ethoxy-N-(2-fluorophenyl)-2-methylquinolin-4-amine;hydrochloride |
| SMILES | CCOc1ccc2nc(C)cc(Nc3ccccc3F)c2c1.Cl |
| InChI | InChI=1S/C18H17FN2O.ClH/c1-3-22-13-8-9-16-14(11-13)18(10-12(2)20-16)21-17-7-5-4-6-15(17)19;/h4-11H,3H2,1-2H3,(H,20,21);1H |
| InChIKey | BMCNGGXJAZTAGH-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.81 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |