C21H19N3OS — CID 169487705
N-(6-ethoxy-2-methylquinolin-4-yl)-4-phenyl-1,3-thiazol-2-amine (PubChem CID 169487705) has the molecular formula C21H19N3OS and a molecular weight of 361.47 g/mol. Its IUPAC name is N-(6-ethoxy-2-methylquinolin-4-yl)-4-phenyl-1,3-thiazol-2-amine.
| Compound Name | N-(6-ethoxy-2-methylquinolin-4-yl)-4-phenyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 169487705 |
| Molecular Formula | C21H19N3OS |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | N-(6-ethoxy-2-methylquinolin-4-yl)-4-phenyl-1,3-thiazol-2-amine |
| SMILES | CCOc1ccc2nc(C)cc(Nc3nc(-c4ccccc4)cs3)c2c1 |
| InChI | InChI=1S/C21H19N3OS/c1-3-25-16-9-10-18-17(12-16)19(11-14(2)22-18)23-21-24-20(13-26-21)15-7-5-4-6-8-15/h4-13H,3H2,1-2H3,(H,22,23,24) |
| InChIKey | XPUIITLNCKGFBC-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |