C16H15N3OS — CID 29457657
4-(4-ethoxyphenyl)-N-pyridin-2-yl-1,3-thiazol-2-amine (PubChem CID 29457657) has the molecular formula C16H15N3OS and a molecular weight of 297.38 g/mol. Its IUPAC name is 4-(4-ethoxyphenyl)-N-pyridin-2-yl-1,3-thiazol-2-amine.
| Compound Name | 4-(4-ethoxyphenyl)-N-pyridin-2-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 29457657 |
| Molecular Formula | C16H15N3OS |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 4-(4-ethoxyphenyl)-N-pyridin-2-yl-1,3-thiazol-2-amine |
| SMILES | CCOc1ccc(-c2csc(Nc3ccccn3)n2)cc1 |
| InChI | InChI=1S/C16H15N3OS/c1-2-20-13-8-6-12(7-9-13)14-11-21-16(18-14)19-15-5-3-4-10-17-15/h3-11H,2H2,1H3,(H,17,18,19) |
| InChIKey | GJDFNMNXKWSVSC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |