C20H22N2OS — CID 23889663
N-(4-ethoxyphenyl)-4-(4-propan-2-ylphenyl)-1,3-thiazol-2-amine (PubChem CID 23889663) has the molecular formula C20H22N2OS and a molecular weight of 338.48 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-4-(4-propan-2-ylphenyl)-1,3-thiazol-2-amine.
| Compound Name | N-(4-ethoxyphenyl)-4-(4-propan-2-ylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 23889663 |
| Molecular Formula | C20H22N2OS |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | N-(4-ethoxyphenyl)-4-(4-propan-2-ylphenyl)-1,3-thiazol-2-amine |
| SMILES | CCOc1ccc(Nc2nc(-c3ccc(C(C)C)cc3)cs2)cc1 |
| InChI | InChI=1S/C20H22N2OS/c1-4-23-18-11-9-17(10-12-18)21-20-22-19(13-24-20)16-7-5-15(6-8-16)14(2)3/h5-14H,4H2,1-3H3,(H,21,22) |
| InChIKey | SRIVEORFBFHLGO-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |