C14H18N2S — CID 55027194
N-ethyl-4-(4-propan-2-ylphenyl)-1,3-thiazol-2-amine (PubChem CID 55027194) has the molecular formula C14H18N2S and a molecular weight of 246.38 g/mol. Its IUPAC name is N-ethyl-4-(4-propan-2-ylphenyl)-1,3-thiazol-2-amine.
| Compound Name | N-ethyl-4-(4-propan-2-ylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 55027194 |
| Molecular Formula | C14H18N2S |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | N-ethyl-4-(4-propan-2-ylphenyl)-1,3-thiazol-2-amine |
| SMILES | CCNc1nc(-c2ccc(C(C)C)cc2)cs1 |
| InChI | InChI=1S/C14H18N2S/c1-4-15-14-16-13(9-17-14)12-7-5-11(6-8-12)10(2)3/h5-10H,4H2,1-3H3,(H,15,16) |
| InChIKey | WYSOVCYVKIRMMY-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |