C15H10F3N3OS — CID 122499786
N-pyridin-2-yl-4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-amine (PubChem CID 122499786) has the molecular formula C15H10F3N3OS and a molecular weight of 337.33 g/mol. Its IUPAC name is N-pyridin-2-yl-4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-amine.
| Compound Name | N-pyridin-2-yl-4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 122499786 |
| Molecular Formula | C15H10F3N3OS |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | N-pyridin-2-yl-4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-amine |
| SMILES | FC(F)(F)Oc1ccc(-c2csc(Nc3ccccn3)n2)cc1 |
| InChI | InChI=1S/C15H10F3N3OS/c16-15(17,18)22-11-6-4-10(5-7-11)12-9-23-14(20-12)21-13-3-1-2-8-19-13/h1-9H,(H,19,20,21) |
| InChIKey | YLLAEUNHTRQYOT-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |