C22H24N2O5 — CID 25022707
methyl 2-[(6-ethoxy-2-methylquinolin-4-yl)amino]-4,5-dimethoxybenzoate (PubChem CID 25022707) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is methyl 2-[(6-ethoxy-2-methylquinolin-4-yl)amino]-4,5-dimethoxybenzoate.
| Compound Name | methyl 2-[(6-ethoxy-2-methylquinolin-4-yl)amino]-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 25022707 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | methyl 2-[(6-ethoxy-2-methylquinolin-4-yl)amino]-4,5-dimethoxybenzoate |
| SMILES | CCOc1ccc2nc(C)cc(Nc3cc(OC)c(OC)cc3C(=O)OC)c2c1 |
| InChI | InChI=1S/C22H24N2O5/c1-6-29-14-7-8-17-15(10-14)18(9-13(2)23-17)24-19-12-21(27-4)20(26-3)11-16(19)22(25)28-5/h7-12H,6H2,1-5H3,(H,23,24) |
| InChIKey | FRNAOGZMWYOUFR-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |