C18H14ClN2O2- — CID 4257239
4-(4-chloro-2-methylanilino)-2-methylquinoline-6-carboxylate (PubChem CID 4257239) has the molecular formula C18H14ClN2O2- and a molecular weight of 325.78 g/mol. Its IUPAC name is 4-(4-chloro-2-methylanilino)-2-methylquinoline-6-carboxylate.
| Compound Name | 4-(4-chloro-2-methylanilino)-2-methylquinoline-6-carboxylate |
|---|---|
| PubChem CID | 4257239 |
| Molecular Formula | C18H14ClN2O2- |
| Molecular Weight | 325.78 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 4-(4-chloro-2-methylanilino)-2-methylquinoline-6-carboxylate |
| SMILES | Cc1cc(Nc2ccc(Cl)cc2C)c2cc(C(=O)[O-])ccc2n1 |
| InChI | InChI=1S/C18H15ClN2O2/c1-10-7-13(19)4-6-15(10)21-17-8-11(2)20-16-5-3-12(18(22)23)9-14(16)17/h3-9H,1-2H3,(H,20,21)(H,22,23)/p-1 |
| InChIKey | YMZRZZLNRCKKOW-UHFFFAOYSA-M |
| XLogP | 3.61 |
| TPSA | 65.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.78 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |