4-(2,4-dimethylanilino)-2-methylquinoline-6-carboxylic acid

C19H18N2O2 — CID 7719183

IUPAC4-(2,4-dimethylanilino)-2-methylquinoline-6-carboxylic acid
SMILESCc1ccc(Nc2cc(C)nc3ccc(C(=O)O)cc23)c(C)c1
InChIInChI=1S/C19H18N2O2/c1-11-4-6-16(12(2)8-11)21-18-9-13(3)20-17-7-5-14(19(22)23)10-15(17)18/h4-10H,1-3H3,(H,20,21)(H,22,23)
InChIKeyKJIPKTUCBXSIAH-UHFFFAOYSA-N
MW306.37 g/mol
LogP4.60
Rot. Bonds3

About 4-(2,4-dimethylanilino)-2-methylquinoline-6-carboxylic acid

4-(2,4-dimethylanilino)-2-methylquinoline-6-carboxylic acid (PubChem CID 7719183) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is 4-(2,4-dimethylanilino)-2-methylquinoline-6-carboxylic acid.

Molecular Properties

Compound Name4-(2,4-dimethylanilino)-2-methylquinoline-6-carboxylic acid
PubChem CID7719183
Molecular FormulaC19H18N2O2
Molecular Weight306.37 g/mol
Exact Mass306.14
IUPAC Name4-(2,4-dimethylanilino)-2-methylquinoline-6-carboxylic acid
SMILESCc1ccc(Nc2cc(C)nc3ccc(C(=O)O)cc23)c(C)c1
InChIInChI=1S/C19H18N2O2/c1-11-4-6-16(12(2)8-11)21-18-9-13(3)20-17-7-5-14(19(22)23)10-15(17)18/h4-10H,1-3H3,(H,20,21)(H,22,23)
InChIKeyKJIPKTUCBXSIAH-UHFFFAOYSA-N
XLogP4.60
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500306.37
LogP ≤ 54.60
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-(2,4-dimethylanilino)-2-methylquinoline-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,4-dimethylanilino)-2-methylquinoline-6-carboxylic acid?
The IUPAC name of 4-(2,4-dimethylanilino)-2-methylquinoline-6-carboxylic acid (CID 7719183) is 4-(2,4-dimethylanilino)-2-methylquinoline-6-carboxylic acid.
What is the SMILES notation for 4-(2,4-dimethylanilino)-2-methylquinoline-6-carboxylic acid?
The canonical SMILES for 4-(2,4-dimethylanilino)-2-methylquinoline-6-carboxylic acid is Cc1ccc(Nc2cc(C)nc3ccc(C(=O)O)cc23)c(C)c1.
What is the InChIKey of 4-(2,4-dimethylanilino)-2-methylquinoline-6-carboxylic acid?
The InChIKey is KJIPKTUCBXSIAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O2/c1-11-4-6-16(12(2)8-11)21-18-9-13(3)20-17-7-5-14(19(22)23)10-15(17)18/h4-10H,1-3H3,(H,20,21)(H,22,23).
What are the key properties of 4-(2,4-dimethylanilino)-2-methylquinoline-6-carboxylic acid?
4-(2,4-dimethylanilino)-2-methylquinoline-6-carboxylic acid has a molecular weight of 306.37 g/mol, XLogP of 4.60, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-dimethylanilino)-2-methylquinoline-6-carboxylic acid is sourced from PubChem (CID 7719183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).