C14H16N2O3 — CID 7137915
4-(2-methoxyethylamino)-2-methylquinoline-6-carboxylic acid (PubChem CID 7137915) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is 4-(2-methoxyethylamino)-2-methylquinoline-6-carboxylic acid.
| Compound Name | 4-(2-methoxyethylamino)-2-methylquinoline-6-carboxylic acid |
|---|---|
| PubChem CID | 7137915 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 4-(2-methoxyethylamino)-2-methylquinoline-6-carboxylic acid |
| SMILES | COCCNc1cc(C)nc2ccc(C(=O)O)cc12 |
| InChI | InChI=1S/C14H16N2O3/c1-9-7-13(15-5-6-19-2)11-8-10(14(17)18)3-4-12(11)16-9/h3-4,7-8H,5-6H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | ZCJGFWUGJDEXQQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|