C25H20N2O4 — CID 54071769
4-[[4-(2-carboxyphenyl)phenyl]methylamino]-2-methylquinoline-6-carboxylic acid (PubChem CID 54071769) has the molecular formula C25H20N2O4 and a molecular weight of 412.45 g/mol. Its IUPAC name is 4-[[4-(2-carboxyphenyl)phenyl]methylamino]-2-methylquinoline-6-carboxylic acid.
| Compound Name | 4-[[4-(2-carboxyphenyl)phenyl]methylamino]-2-methylquinoline-6-carboxylic acid |
|---|---|
| PubChem CID | 54071769 |
| Molecular Formula | C25H20N2O4 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 4-[[4-(2-carboxyphenyl)phenyl]methylamino]-2-methylquinoline-6-carboxylic acid |
| SMILES | Cc1cc(NCc2ccc(-c3ccccc3C(=O)O)cc2)c2cc(C(=O)O)ccc2n1 |
| InChI | InChI=1S/C25H20N2O4/c1-15-12-23(21-13-18(24(28)29)10-11-22(21)27-15)26-14-16-6-8-17(9-7-16)19-4-2-3-5-20(19)25(30)31/h2-13H,14H2,1H3,(H,26,27)(H,28,29)(H,30,31) |
| InChIKey | MGYKMEVZBSLFGC-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |