C24H26N2O3 — CID 17016302
ethyl 4-[(4-tert-butylbenzoyl)amino]-2-methylquinoline-6-carboxylate (PubChem CID 17016302) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is ethyl 4-[(4-tert-butylbenzoyl)amino]-2-methylquinoline-6-carboxylate.
| Compound Name | ethyl 4-[(4-tert-butylbenzoyl)amino]-2-methylquinoline-6-carboxylate |
|---|---|
| PubChem CID | 17016302 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | ethyl 4-[(4-tert-butylbenzoyl)amino]-2-methylquinoline-6-carboxylate |
| SMILES | CCOC(=O)c1ccc2nc(C)cc(NC(=O)c3ccc(C(C)(C)C)cc3)c2c1 |
| InChI | InChI=1S/C24H26N2O3/c1-6-29-23(28)17-9-12-20-19(14-17)21(13-15(2)25-20)26-22(27)16-7-10-18(11-8-16)24(3,4)5/h7-14H,6H2,1-5H3,(H,25,26,27) |
| InChIKey | AWZYMFBYLGPIEG-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |