C21H21ClN2O3 — CID 2917853
ethyl 4-(3-acetylanilino)-2-methylquinoline-6-carboxylate;hydrochloride (PubChem CID 2917853) has the molecular formula C21H21ClN2O3 and a molecular weight of 384.86 g/mol. Its IUPAC name is ethyl 4-(3-acetylanilino)-2-methylquinoline-6-carboxylate;hydrochloride.
| Compound Name | ethyl 4-(3-acetylanilino)-2-methylquinoline-6-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 2917853 |
| Molecular Formula | C21H21ClN2O3 |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | ethyl 4-(3-acetylanilino)-2-methylquinoline-6-carboxylate;hydrochloride |
| SMILES | CCOC(=O)c1ccc2nc(C)cc(Nc3cccc(C(C)=O)c3)c2c1.Cl |
| InChI | InChI=1S/C21H20N2O3.ClH/c1-4-26-21(25)16-8-9-19-18(12-16)20(10-13(2)22-19)23-17-7-5-6-15(11-17)14(3)24;/h5-12H,4H2,1-3H3,(H,22,23);1H |
| InChIKey | PMLHCKBUMVYESB-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |