C15H20N3NaO3 — CID 172712956
sodium;4-[2-(dimethylamino)ethylamino]-2-methylquinoline-6-carboxylic acid;hydroxide (PubChem CID 172712956) has the molecular formula C15H20N3NaO3 and a molecular weight of 313.33 g/mol. Its IUPAC name is sodium;4-[2-(dimethylamino)ethylamino]-2-methylquinoline-6-carboxylic acid;hydroxide.
| Compound Name | sodium;4-[2-(dimethylamino)ethylamino]-2-methylquinoline-6-carboxylic acid;hydroxide |
|---|---|
| PubChem CID | 172712956 |
| Molecular Formula | C15H20N3NaO3 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | sodium;4-[2-(dimethylamino)ethylamino]-2-methylquinoline-6-carboxylic acid;hydroxide |
| SMILES | Cc1cc(NCCN(C)C)c2cc(C(=O)O)ccc2n1.[Na+].[OH-] |
| InChI | InChI=1S/C15H19N3O2.Na.H2O/c1-10-8-14(16-6-7-18(2)3)12-9-11(15(19)20)4-5-13(12)17-10;;/h4-5,8-9H,6-7H2,1-3H3,(H,16,17)(H,19,20);;1H2/q;+1;/p-1 |
| InChIKey | FMGCLTCYKWCGMC-UHFFFAOYSA-M |
| XLogP | -0.96 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |