C22H24N4O2 — CID 7138021
2-methyl-4-[4-(4-methylpiperazin-1-yl)anilino]quinoline-6-carboxylic acid (PubChem CID 7138021) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is 2-methyl-4-[4-(4-methylpiperazin-1-yl)anilino]quinoline-6-carboxylic acid.
| Compound Name | 2-methyl-4-[4-(4-methylpiperazin-1-yl)anilino]quinoline-6-carboxylic acid |
|---|---|
| PubChem CID | 7138021 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 2-methyl-4-[4-(4-methylpiperazin-1-yl)anilino]quinoline-6-carboxylic acid |
| SMILES | Cc1cc(Nc2ccc(N3CCN(C)CC3)cc2)c2cc(C(=O)O)ccc2n1 |
| InChI | InChI=1S/C22H24N4O2/c1-15-13-21(19-14-16(22(27)28)3-8-20(19)23-15)24-17-4-6-18(7-5-17)26-11-9-25(2)10-12-26/h3-8,13-14H,9-12H2,1-2H3,(H,23,24)(H,27,28) |
| InChIKey | GEWDALPATCXWSR-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|