C24H28N6O2 — CID 175783724
2-N,2-N-dimethyl-3-[4-(4-methylpiperazin-1-yl)anilino]quinoline-2,6-dicarboxamide (PubChem CID 175783724) has the molecular formula C24H28N6O2 and a molecular weight of 432.53 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-3-[4-(4-methylpiperazin-1-yl)anilino]quinoline-2,6-dicarboxamide.
| Compound Name | 2-N,2-N-dimethyl-3-[4-(4-methylpiperazin-1-yl)anilino]quinoline-2,6-dicarboxamide |
|---|---|
| PubChem CID | 175783724 |
| Molecular Formula | C24H28N6O2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 2-N,2-N-dimethyl-3-[4-(4-methylpiperazin-1-yl)anilino]quinoline-2,6-dicarboxamide |
| SMILES | CN1CCN(c2ccc(Nc3cc4cc(C(N)=O)ccc4nc3C(=O)N(C)C)cc2)CC1 |
| InChI | InChI=1S/C24H28N6O2/c1-28(2)24(32)22-21(15-17-14-16(23(25)31)4-9-20(17)27-22)26-18-5-7-19(8-6-18)30-12-10-29(3)11-13-30/h4-9,14-15,26H,10-13H2,1-3H3,(H2,25,31) |
| InChIKey | MPJXASFEGRKYOP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 94.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|