C17H19ClFN5O — CID 57489643
2-chloro-5-fluoro-6-[4-(4-methylpiperazin-1-yl)anilino]pyridine-3-carboxamide (PubChem CID 57489643) has the molecular formula C17H19ClFN5O and a molecular weight of 363.82 g/mol. Its IUPAC name is 2-chloro-5-fluoro-6-[4-(4-methylpiperazin-1-yl)anilino]pyridine-3-carboxamide.
| Compound Name | 2-chloro-5-fluoro-6-[4-(4-methylpiperazin-1-yl)anilino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 57489643 |
| Molecular Formula | C17H19ClFN5O |
| Molecular Weight | 363.82 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 2-chloro-5-fluoro-6-[4-(4-methylpiperazin-1-yl)anilino]pyridine-3-carboxamide |
| SMILES | CN1CCN(c2ccc(Nc3nc(Cl)c(C(N)=O)cc3F)cc2)CC1 |
| InChI | InChI=1S/C17H19ClFN5O/c1-23-6-8-24(9-7-23)12-4-2-11(3-5-12)21-17-14(19)10-13(16(20)25)15(18)22-17/h2-5,10H,6-9H2,1H3,(H2,20,25)(H,21,22) |
| InChIKey | JXWYPEBDYMGFBR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.82 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|