C19H24ClFN6O2 — CID 88569782
5-chloro-3-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]-6-(2-hydroxypropan-2-yl)pyrazine-2-carboxamide (PubChem CID 88569782) has the molecular formula C19H24ClFN6O2 and a molecular weight of 422.89 g/mol. Its IUPAC name is 5-chloro-3-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]-6-(2-hydroxypropan-2-yl)pyrazine-2-carboxamide.
| Compound Name | 5-chloro-3-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]-6-(2-hydroxypropan-2-yl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 88569782 |
| Molecular Formula | C19H24ClFN6O2 |
| Molecular Weight | 422.89 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 5-chloro-3-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]-6-(2-hydroxypropan-2-yl)pyrazine-2-carboxamide |
| SMILES | CN1CCN(c2ccc(Nc3nc(Cl)c(C(C)(C)O)nc3C(N)=O)cc2F)CC1 |
| InChI | InChI=1S/C19H24ClFN6O2/c1-19(2,29)15-16(20)25-18(14(24-15)17(22)28)23-11-4-5-13(12(21)10-11)27-8-6-26(3)7-9-27/h4-5,10,29H,6-9H2,1-3H3,(H2,22,28)(H,23,25) |
| InChIKey | JHMXFWHVIQFRAF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.89 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|