C19H25ClN6O — CID 87092141
5-chloro-6-ethyl-3-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]pyrazine-2-carboxamide (PubChem CID 87092141) has the molecular formula C19H25ClN6O and a molecular weight of 388.90 g/mol. Its IUPAC name is 5-chloro-6-ethyl-3-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]pyrazine-2-carboxamide.
| Compound Name | 5-chloro-6-ethyl-3-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 87092141 |
| Molecular Formula | C19H25ClN6O |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 5-chloro-6-ethyl-3-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]pyrazine-2-carboxamide |
| SMILES | CCc1nc(C(N)=O)c(Nc2ccc(N3CCN(C)CC3)c(C)c2)nc1Cl |
| InChI | InChI=1S/C19H25ClN6O/c1-4-14-17(20)24-19(16(23-14)18(21)27)22-13-5-6-15(12(2)11-13)26-9-7-25(3)8-10-26/h5-6,11H,4,7-10H2,1-3H3,(H2,21,27)(H,22,24) |
| InChIKey | GETIZDJQUQIXNG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|