C30H44N8O2 — CID 159644679
6-ethyl-3-[3-methyl-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]-5-(4-oxohex-5-enylamino)pyrazine-2-carboxamide (PubChem CID 159644679) has the molecular formula C30H44N8O2 and a molecular weight of 548.74 g/mol. Its IUPAC name is 6-ethyl-3-[3-methyl-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]-5-(4-oxohex-5-enylamino)pyrazine-2-carboxamide.
| Compound Name | 6-ethyl-3-[3-methyl-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]-5-(4-oxohex-5-enylamino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 159644679 |
| Molecular Formula | C30H44N8O2 |
| Molecular Weight | 548.74 g/mol |
| Exact Mass | 548.36 |
| IUPAC Name | 6-ethyl-3-[3-methyl-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]-5-(4-oxohex-5-enylamino)pyrazine-2-carboxamide |
| SMILES | C=CC(=O)CCCNc1nc(Nc2ccc(N3CCC(N4CCN(C)CC4)CC3)c(C)c2)c(C(N)=O)nc1CC |
| InChI | InChI=1S/C30H44N8O2/c1-5-24(39)8-7-13-32-29-25(6-2)34-27(28(31)40)30(35-29)33-22-9-10-26(21(3)20-22)38-14-11-23(12-15-38)37-18-16-36(4)17-19-37/h5,9-10,20,23H,1,6-8,11-19H2,2-4H3,(H2,31,40)(H2,32,33,35) |
| InChIKey | MQUNXLBCUILTKL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 119.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.74 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|