C33H49N9O6 — CID 176655227
6-ethyl-3-[4-[4-[4-[5-(hydroxyamino)-5-oxopentanoyl]piperazin-1-yl]piperidin-1-yl]-3-methoxyanilino]-5-(oxan-4-ylamino)pyrazine-2-carboxamide (PubChem CID 176655227) has the molecular formula C33H49N9O6 and a molecular weight of 667.81 g/mol. Its IUPAC name is 6-ethyl-3-[4-[4-[4-[5-(hydroxyamino)-5-oxopentanoyl]piperazin-1-yl]piperidin-1-yl]-3-methoxyanilino]-5-(oxan-4-ylamino)pyrazine-2-carboxamide.
| Compound Name | 6-ethyl-3-[4-[4-[4-[5-(hydroxyamino)-5-oxopentanoyl]piperazin-1-yl]piperidin-1-yl]-3-methoxyanilino]-5-(oxan-4-ylamino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 176655227 |
| Molecular Formula | C33H49N9O6 |
| Molecular Weight | 667.81 g/mol |
| Exact Mass | 667.38 |
| IUPAC Name | 6-ethyl-3-[4-[4-[4-[5-(hydroxyamino)-5-oxopentanoyl]piperazin-1-yl]piperidin-1-yl]-3-methoxyanilino]-5-(oxan-4-ylamino)pyrazine-2-carboxamide |
| SMILES | CCc1nc(C(N)=O)c(Nc2ccc(N3CCC(N4CCN(C(=O)CCCC(=O)NO)CC4)CC3)c(OC)c2)nc1NC1CCOCC1 |
| InChI | InChI=1S/C33H49N9O6/c1-3-25-32(35-22-11-19-48-20-12-22)38-33(30(37-25)31(34)45)36-23-7-8-26(27(21-23)47-2)41-13-9-24(10-14-41)40-15-17-42(18-16-40)29(44)6-4-5-28(43)39-46/h7-8,21-22,24,46H,3-6,9-20H2,1-2H3,(H2,34,45)(H,39,43)(H2,35,36,38) |
| InChIKey | YUWWDZQWACYRDB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 187.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.81 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|