C23H30N6O4 — CID 139575939
3-[[(4aR)-2,4,4a,5-tetrahydro-1H-[1,4]oxazino[3,4-c][1,4]benzoxazin-8-yl]amino]-6-ethyl-5-(oxan-4-ylamino)pyrazine-2-carboxamide (PubChem CID 139575939) has the molecular formula C23H30N6O4 and a molecular weight of 454.53 g/mol. Its IUPAC name is 3-[[(4aR)-2,4,4a,5-tetrahydro-1H-[1,4]oxazino[3,4-c][1,4]benzoxazin-8-yl]amino]-6-ethyl-5-(oxan-4-ylamino)pyrazine-2-carboxamide.
| Compound Name | 3-[[(4aR)-2,4,4a,5-tetrahydro-1H-[1,4]oxazino[3,4-c][1,4]benzoxazin-8-yl]amino]-6-ethyl-5-(oxan-4-ylamino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 139575939 |
| Molecular Formula | C23H30N6O4 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | 3-[[(4aR)-2,4,4a,5-tetrahydro-1H-[1,4]oxazino[3,4-c][1,4]benzoxazin-8-yl]amino]-6-ethyl-5-(oxan-4-ylamino)pyrazine-2-carboxamide |
| SMILES | CCc1nc(C(N)=O)c(Nc2ccc3c(c2)OC[C@H]2COCCN32)nc1NC1CCOCC1 |
| InChI | InChI=1S/C23H30N6O4/c1-2-17-22(25-14-5-8-31-9-6-14)28-23(20(27-17)21(24)30)26-15-3-4-18-19(11-15)33-13-16-12-32-10-7-29(16)18/h3-4,11,14,16H,2,5-10,12-13H2,1H3,(H2,24,30)(H2,25,26,28)/t16-/m1/s1 |
| InChIKey | FJFINZIEVOYNHY-MRXNPFEDSA-N |
| XLogP | 2.07 |
| TPSA | 123.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |