C25H39N7O3 — CID 167486828
6-ethyl-3-[3-(2-formamidoethyl)anilino]-5-(oxan-4-ylamino)pyrazine-2-carboxamide;N-methylpropan-2-amine (PubChem CID 167486828) has the molecular formula C25H39N7O3 and a molecular weight of 485.63 g/mol. Its IUPAC name is 6-ethyl-3-[3-(2-formamidoethyl)anilino]-5-(oxan-4-ylamino)pyrazine-2-carboxamide;N-methylpropan-2-amine.
| Compound Name | 6-ethyl-3-[3-(2-formamidoethyl)anilino]-5-(oxan-4-ylamino)pyrazine-2-carboxamide;N-methylpropan-2-amine |
|---|---|
| PubChem CID | 167486828 |
| Molecular Formula | C25H39N7O3 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.31 |
| IUPAC Name | 6-ethyl-3-[3-(2-formamidoethyl)anilino]-5-(oxan-4-ylamino)pyrazine-2-carboxamide;N-methylpropan-2-amine |
| SMILES | CCc1nc(C(N)=O)c(Nc2cccc(CCNC=O)c2)nc1NC1CCOCC1.CNC(C)C |
| InChI | InChI=1S/C21H28N6O3.C4H11N/c1-2-17-20(24-15-7-10-30-11-8-15)27-21(18(26-17)19(22)29)25-16-5-3-4-14(12-16)6-9-23-13-28;1-4(2)5-3/h3-5,12-13,15H,2,6-11H2,1H3,(H2,22,29)(H,23,28)(H2,24,25,27);4-5H,1-3H3 |
| InChIKey | BYZQTKXICPMJJR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 143.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|