C20H28N6O3S — CID 174653729
[3-[[3-carbamoyl-5-ethyl-6-[(1-methylpiperidin-3-yl)amino]pyrazin-2-yl]amino]phenyl]methanesulfinic acid (PubChem CID 174653729) has the molecular formula C20H28N6O3S and a molecular weight of 432.55 g/mol. Its IUPAC name is [3-[[3-carbamoyl-5-ethyl-6-[(1-methylpiperidin-3-yl)amino]pyrazin-2-yl]amino]phenyl]methanesulfinic acid.
| Compound Name | [3-[[3-carbamoyl-5-ethyl-6-[(1-methylpiperidin-3-yl)amino]pyrazin-2-yl]amino]phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 174653729 |
| Molecular Formula | C20H28N6O3S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | [3-[[3-carbamoyl-5-ethyl-6-[(1-methylpiperidin-3-yl)amino]pyrazin-2-yl]amino]phenyl]methanesulfinic acid |
| SMILES | CCc1nc(C(N)=O)c(Nc2cccc(CS(=O)O)c2)nc1NC1CCCN(C)C1 |
| InChI | InChI=1S/C20H28N6O3S/c1-3-16-19(23-15-8-5-9-26(2)11-15)25-20(17(24-16)18(21)27)22-14-7-4-6-13(10-14)12-30(28)29/h4,6-7,10,15H,3,5,8-9,11-12H2,1-2H3,(H2,21,27)(H,28,29)(H2,22,23,25) |
| InChIKey | QAZDAHRCYBBCHY-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|