C23H28N6O3 — CID 167487020
3-[3-(3-acetamidoprop-1-ynyl)anilino]-6-ethyl-5-(oxan-4-ylamino)pyrazine-2-carboxamide (PubChem CID 167487020) has the molecular formula C23H28N6O3 and a molecular weight of 436.52 g/mol. Its IUPAC name is 3-[3-(3-acetamidoprop-1-ynyl)anilino]-6-ethyl-5-(oxan-4-ylamino)pyrazine-2-carboxamide.
| Compound Name | 3-[3-(3-acetamidoprop-1-ynyl)anilino]-6-ethyl-5-(oxan-4-ylamino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 167487020 |
| Molecular Formula | C23H28N6O3 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | 3-[3-(3-acetamidoprop-1-ynyl)anilino]-6-ethyl-5-(oxan-4-ylamino)pyrazine-2-carboxamide |
| SMILES | CCc1nc(C(N)=O)c(Nc2cccc(C#CCNC(C)=O)c2)nc1NC1CCOCC1 |
| InChI | InChI=1S/C23H28N6O3/c1-3-19-22(26-17-9-12-32-13-10-17)29-23(20(28-19)21(24)31)27-18-8-4-6-16(14-18)7-5-11-25-15(2)30/h4,6,8,14,17H,3,9-13H2,1-2H3,(H2,24,31)(H,25,30)(H2,26,27,29) |
| InChIKey | VCJMHIUSYLZFIT-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 131.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|