C27H36N6O5 — CID 167486876
tert-butyl N-[3-[3-[[3-carbamoyl-5-(cyclopropen-1-yl)-6-(oxan-4-ylamino)pyrazin-2-yl]amino]phenoxy]propyl]carbamate (PubChem CID 167486876) has the molecular formula C27H36N6O5 and a molecular weight of 524.62 g/mol. Its IUPAC name is tert-butyl N-[3-[3-[[3-carbamoyl-5-(cyclopropen-1-yl)-6-(oxan-4-ylamino)pyrazin-2-yl]amino]phenoxy]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-[[3-carbamoyl-5-(cyclopropen-1-yl)-6-(oxan-4-ylamino)pyrazin-2-yl]amino]phenoxy]propyl]carbamate |
|---|---|
| PubChem CID | 167486876 |
| Molecular Formula | C27H36N6O5 |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.27 |
| IUPAC Name | tert-butyl N-[3-[3-[[3-carbamoyl-5-(cyclopropen-1-yl)-6-(oxan-4-ylamino)pyrazin-2-yl]amino]phenoxy]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCOc1cccc(Nc2nc(NC3CCOCC3)c(C3=CC3)nc2C(N)=O)c1 |
| InChI | InChI=1S/C27H36N6O5/c1-27(2,3)38-26(35)29-12-5-13-37-20-7-4-6-19(16-20)31-25-22(23(28)34)32-21(17-8-9-17)24(33-25)30-18-10-14-36-15-11-18/h4,6-8,16,18H,5,9-15H2,1-3H3,(H2,28,34)(H,29,35)(H2,30,31,33) |
| InChIKey | IJEYCDFDABRNPY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 149.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|