C23H30N8O3 — CID 167487469
6-ethyl-5-(oxan-4-ylamino)-3-[[2-[3-(prop-2-ynoylamino)propylamino]-4-pyridinyl]amino]pyrazine-2-carboxamide (PubChem CID 167487469) has the molecular formula C23H30N8O3 and a molecular weight of 466.55 g/mol. Its IUPAC name is 6-ethyl-5-(oxan-4-ylamino)-3-[[2-[3-(prop-2-ynoylamino)propylamino]-4-pyridinyl]amino]pyrazine-2-carboxamide.
| Compound Name | 6-ethyl-5-(oxan-4-ylamino)-3-[[2-[3-(prop-2-ynoylamino)propylamino]-4-pyridinyl]amino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 167487469 |
| Molecular Formula | C23H30N8O3 |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | 6-ethyl-5-(oxan-4-ylamino)-3-[[2-[3-(prop-2-ynoylamino)propylamino]-4-pyridinyl]amino]pyrazine-2-carboxamide |
| SMILES | C#CC(=O)NCCCNc1cc(Nc2nc(NC3CCOCC3)c(CC)nc2C(N)=O)ccn1 |
| InChI | InChI=1S/C23H30N8O3/c1-3-17-22(28-15-7-12-34-13-8-15)31-23(20(30-17)21(24)33)29-16-6-11-26-18(14-16)25-9-5-10-27-19(32)4-2/h2,6,11,14-15H,3,5,7-10,12-13H2,1H3,(H2,24,33)(H,27,32)(H3,25,26,28,29,31) |
| InChIKey | NVYNGCPWAXCTFT-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 156.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|