C24H32N6O4 — CID 167486999
6-ethyl-5-(oxan-4-ylamino)-3-[3-[3-(prop-2-enoylamino)propoxy]anilino]pyrazine-2-carboxamide (PubChem CID 167486999) has the molecular formula C24H32N6O4 and a molecular weight of 468.56 g/mol. Its IUPAC name is 6-ethyl-5-(oxan-4-ylamino)-3-[3-[3-(prop-2-enoylamino)propoxy]anilino]pyrazine-2-carboxamide.
| Compound Name | 6-ethyl-5-(oxan-4-ylamino)-3-[3-[3-(prop-2-enoylamino)propoxy]anilino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 167486999 |
| Molecular Formula | C24H32N6O4 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 6-ethyl-5-(oxan-4-ylamino)-3-[3-[3-(prop-2-enoylamino)propoxy]anilino]pyrazine-2-carboxamide |
| SMILES | C=CC(=O)NCCCOc1cccc(Nc2nc(NC3CCOCC3)c(CC)nc2C(N)=O)c1 |
| InChI | InChI=1S/C24H32N6O4/c1-3-19-23(27-16-9-13-33-14-10-16)30-24(21(29-19)22(25)32)28-17-7-5-8-18(15-17)34-12-6-11-26-20(31)4-2/h4-5,7-8,15-16H,2-3,6,9-14H2,1H3,(H2,25,32)(H,26,31)(H2,27,28,30) |
| InChIKey | CPPRVEHPTIOMBD-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 140.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|