C19H28N6O3 — CID 167487439
3-[(3-aminooxy-6-methylcyclohexa-1,3-dien-1-yl)amino]-6-ethyl-5-(oxan-4-ylamino)pyrazine-2-carboxamide (PubChem CID 167487439) has the molecular formula C19H28N6O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is 3-[(3-aminooxy-6-methylcyclohexa-1,3-dien-1-yl)amino]-6-ethyl-5-(oxan-4-ylamino)pyrazine-2-carboxamide.
| Compound Name | 3-[(3-aminooxy-6-methylcyclohexa-1,3-dien-1-yl)amino]-6-ethyl-5-(oxan-4-ylamino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 167487439 |
| Molecular Formula | C19H28N6O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 3-[(3-aminooxy-6-methylcyclohexa-1,3-dien-1-yl)amino]-6-ethyl-5-(oxan-4-ylamino)pyrazine-2-carboxamide |
| SMILES | CCc1nc(C(N)=O)c(NC2=CC(ON)=CCC2C)nc1NC1CCOCC1 |
| InChI | InChI=1S/C19H28N6O3/c1-3-14-18(22-12-6-8-27-9-7-12)25-19(16(23-14)17(20)26)24-15-10-13(28-21)5-4-11(15)2/h5,10-12H,3-4,6-9,21H2,1-2H3,(H2,20,26)(H2,22,24,25) |
| InChIKey | SNFRXAICJQJMPC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 137.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|