C17H27NO3 — CID 113100474
tert-butyl N-[2-(3-tert-butylphenoxy)ethyl]carbamate (PubChem CID 113100474) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is tert-butyl N-[2-(3-tert-butylphenoxy)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(3-tert-butylphenoxy)ethyl]carbamate |
|---|---|
| PubChem CID | 113100474 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | tert-butyl N-[2-(3-tert-butylphenoxy)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOc1cccc(C(C)(C)C)c1 |
| InChI | InChI=1S/C17H27NO3/c1-16(2,3)13-8-7-9-14(12-13)20-11-10-18-15(19)21-17(4,5)6/h7-9,12H,10-11H2,1-6H3,(H,18,19) |
| InChIKey | KSCHRKIQIVZMJB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|