C18H27NO4S — CID 122440582
S-[[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]phenyl]methyl] 2-methylpropanethioate (PubChem CID 122440582) has the molecular formula C18H27NO4S and a molecular weight of 353.48 g/mol. Its IUPAC name is S-[[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]phenyl]methyl] 2-methylpropanethioate.
| Compound Name | S-[[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]phenyl]methyl] 2-methylpropanethioate |
|---|---|
| PubChem CID | 122440582 |
| Molecular Formula | C18H27NO4S |
| Molecular Weight | 353.48 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | S-[[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]phenyl]methyl] 2-methylpropanethioate |
| SMILES | CC(C)C(=O)SCc1cccc(OCCNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C18H27NO4S/c1-13(2)16(20)24-12-14-7-6-8-15(11-14)22-10-9-19-17(21)23-18(3,4)5/h6-8,11,13H,9-10,12H2,1-5H3,(H,19,21) |
| InChIKey | QMLLSEZDLXXZPT-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|