C21H31N3O4S — CID 170705426
tert-butyl N-[3-[3-[2-[(N-methyl-C-prop-1-en-2-ylsulfanylcarbonimidoyl)amino]-2-oxoethyl]phenoxy]propyl]carbamate (PubChem CID 170705426) has the molecular formula C21H31N3O4S and a molecular weight of 421.56 g/mol. Its IUPAC name is tert-butyl N-[3-[3-[2-[(N-methyl-C-prop-1-en-2-ylsulfanylcarbonimidoyl)amino]-2-oxoethyl]phenoxy]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-[2-[(N-methyl-C-prop-1-en-2-ylsulfanylcarbonimidoyl)amino]-2-oxoethyl]phenoxy]propyl]carbamate |
|---|---|
| PubChem CID | 170705426 |
| Molecular Formula | C21H31N3O4S |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | tert-butyl N-[3-[3-[2-[(N-methyl-C-prop-1-en-2-ylsulfanylcarbonimidoyl)amino]-2-oxoethyl]phenoxy]propyl]carbamate |
| SMILES | C=C(C)S/C(=N\C)NC(=O)Cc1cccc(OCCCNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C21H31N3O4S/c1-15(2)29-19(22-6)24-18(25)14-16-9-7-10-17(13-16)27-12-8-11-23-20(26)28-21(3,4)5/h7,9-10,13H,1,8,11-12,14H2,2-6H3,(H,23,26)(H,22,24,25) |
| InChIKey | BVNIFMAPTONXDK-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|