C21H28N2O2 — CID 112972688
1-[2-(3-tert-butylphenoxy)ethyl]-3-[(3-methylphenyl)methyl]urea (PubChem CID 112972688) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 1-[2-(3-tert-butylphenoxy)ethyl]-3-[(3-methylphenyl)methyl]urea.
| Compound Name | 1-[2-(3-tert-butylphenoxy)ethyl]-3-[(3-methylphenyl)methyl]urea |
|---|---|
| PubChem CID | 112972688 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | 1-[2-(3-tert-butylphenoxy)ethyl]-3-[(3-methylphenyl)methyl]urea |
| SMILES | Cc1cccc(CNC(=O)NCCOc2cccc(C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C21H28N2O2/c1-16-7-5-8-17(13-16)15-23-20(24)22-11-12-25-19-10-6-9-18(14-19)21(2,3)4/h5-10,13-14H,11-12,15H2,1-4H3,(H2,22,23,24) |
| InChIKey | HIJKHTAKJFJYEV-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|