C17H19BrN2O2 — CID 112971155
1-[2-(3-bromophenoxy)ethyl]-3-[(3-methylphenyl)methyl]urea (PubChem CID 112971155) has the molecular formula C17H19BrN2O2 and a molecular weight of 363.26 g/mol. Its IUPAC name is 1-[2-(3-bromophenoxy)ethyl]-3-[(3-methylphenyl)methyl]urea.
| Compound Name | 1-[2-(3-bromophenoxy)ethyl]-3-[(3-methylphenyl)methyl]urea |
|---|---|
| PubChem CID | 112971155 |
| Molecular Formula | C17H19BrN2O2 |
| Molecular Weight | 363.26 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 1-[2-(3-bromophenoxy)ethyl]-3-[(3-methylphenyl)methyl]urea |
| SMILES | Cc1cccc(CNC(=O)NCCOc2cccc(Br)c2)c1 |
| InChI | InChI=1S/C17H19BrN2O2/c1-13-4-2-5-14(10-13)12-20-17(21)19-8-9-22-16-7-3-6-15(18)11-16/h2-7,10-11H,8-9,12H2,1H3,(H2,19,20,21) |
| InChIKey | UUVGPUAHNZACLX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.26 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|