C19H25N3O2 — CID 112972702
1-[2-(3-tert-butylphenoxy)ethyl]-3-(pyridin-4-ylmethyl)urea (PubChem CID 112972702) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 1-[2-(3-tert-butylphenoxy)ethyl]-3-(pyridin-4-ylmethyl)urea.
| Compound Name | 1-[2-(3-tert-butylphenoxy)ethyl]-3-(pyridin-4-ylmethyl)urea |
|---|---|
| PubChem CID | 112972702 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 1-[2-(3-tert-butylphenoxy)ethyl]-3-(pyridin-4-ylmethyl)urea |
| SMILES | CC(C)(C)c1cccc(OCCNC(=O)NCc2ccncc2)c1 |
| InChI | InChI=1S/C19H25N3O2/c1-19(2,3)16-5-4-6-17(13-16)24-12-11-21-18(23)22-14-15-7-9-20-10-8-15/h4-10,13H,11-12,14H2,1-3H3,(H2,21,22,23) |
| InChIKey | MLRGYICKDGGRDH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|