C18H25NO4 — CID 120976904
2-[2-(3-tert-butylphenoxy)ethylcarbamoyl]cyclobutane-1-carboxylic acid (PubChem CID 120976904) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is 2-[2-(3-tert-butylphenoxy)ethylcarbamoyl]cyclobutane-1-carboxylic acid.
| Compound Name | 2-[2-(3-tert-butylphenoxy)ethylcarbamoyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 120976904 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 2-[2-(3-tert-butylphenoxy)ethylcarbamoyl]cyclobutane-1-carboxylic acid |
| SMILES | CC(C)(C)c1cccc(OCCNC(=O)C2CCC2C(=O)O)c1 |
| InChI | InChI=1S/C18H25NO4/c1-18(2,3)12-5-4-6-13(11-12)23-10-9-19-16(20)14-7-8-15(14)17(21)22/h4-6,11,14-15H,7-10H2,1-3H3,(H,19,20)(H,21,22) |
| InChIKey | KTIQAZAGEUMDSM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|