C21H27N7O4S — CID 139576136
2-[[(4aR)-3-ethylsulfonyl-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl]amino]-4-(cyclopropylamino)pyrimidine-5-carboxamide (PubChem CID 139576136) has the molecular formula C21H27N7O4S and a molecular weight of 473.56 g/mol. Its IUPAC name is 2-[[(4aR)-3-ethylsulfonyl-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl]amino]-4-(cyclopropylamino)pyrimidine-5-carboxamide.
| Compound Name | 2-[[(4aR)-3-ethylsulfonyl-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl]amino]-4-(cyclopropylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 139576136 |
| Molecular Formula | C21H27N7O4S |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | 2-[[(4aR)-3-ethylsulfonyl-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl]amino]-4-(cyclopropylamino)pyrimidine-5-carboxamide |
| SMILES | CCS(=O)(=O)N1CCN2c3ccc(Nc4ncc(C(N)=O)c(NC5CC5)n4)cc3OC[C@H]2C1 |
| InChI | InChI=1S/C21H27N7O4S/c1-2-33(30,31)27-7-8-28-15(11-27)12-32-18-9-14(5-6-17(18)28)25-21-23-10-16(19(22)29)20(26-21)24-13-3-4-13/h5-6,9-10,13,15H,2-4,7-8,11-12H2,1H3,(H2,22,29)(H2,23,24,25,26)/t15-/m1/s1 |
| InChIKey | XACYSAAZYSAJBZ-OAHLLOKOSA-N |
| XLogP | 1.13 |
| TPSA | 142.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |