C29H41N7O3 — CID 161306961
6-ethyl-3-[4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]-5-(4-oxohex-5-enoxy)pyrazine-2-carboxamide (PubChem CID 161306961) has the molecular formula C29H41N7O3 and a molecular weight of 535.69 g/mol. Its IUPAC name is 6-ethyl-3-[4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]-5-(4-oxohex-5-enoxy)pyrazine-2-carboxamide.
| Compound Name | 6-ethyl-3-[4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]-5-(4-oxohex-5-enoxy)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 161306961 |
| Molecular Formula | C29H41N7O3 |
| Molecular Weight | 535.69 g/mol |
| Exact Mass | 535.33 |
| IUPAC Name | 6-ethyl-3-[4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]-5-(4-oxohex-5-enoxy)pyrazine-2-carboxamide |
| SMILES | C=CC(=O)CCCOc1nc(Nc2ccc(N3CCC(N4CCN(C)CC4)CC3)cc2)c(C(N)=O)nc1CC |
| InChI | InChI=1S/C29H41N7O3/c1-4-24(37)7-6-20-39-29-25(5-2)32-26(27(30)38)28(33-29)31-21-8-10-22(11-9-21)35-14-12-23(13-15-35)36-18-16-34(3)17-19-36/h4,8-11,23H,1,5-7,12-20H2,2-3H3,(H2,30,38)(H,31,33) |
| InChIKey | VIJMRWIAUUYSRS-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.69 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|