C27H28ClN5O — CID 88569575
5-chloro-6-ethyl-3-(3-methyl-4-spiro[indene-1,4'-piperidine]-1'-ylanilino)pyrazine-2-carboxamide (PubChem CID 88569575) has the molecular formula C27H28ClN5O and a molecular weight of 474.01 g/mol. Its IUPAC name is 5-chloro-6-ethyl-3-(3-methyl-4-spiro[indene-1,4'-piperidine]-1'-ylanilino)pyrazine-2-carboxamide.
| Compound Name | 5-chloro-6-ethyl-3-(3-methyl-4-spiro[indene-1,4'-piperidine]-1'-ylanilino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 88569575 |
| Molecular Formula | C27H28ClN5O |
| Molecular Weight | 474.01 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | 5-chloro-6-ethyl-3-(3-methyl-4-spiro[indene-1,4'-piperidine]-1'-ylanilino)pyrazine-2-carboxamide |
| SMILES | CCc1nc(C(N)=O)c(Nc2ccc(N3CCC4(C=Cc5ccccc54)CC3)c(C)c2)nc1Cl |
| InChI | InChI=1S/C27H28ClN5O/c1-3-21-24(28)32-26(23(31-21)25(29)34)30-19-8-9-22(17(2)16-19)33-14-12-27(13-15-33)11-10-18-6-4-5-7-20(18)27/h4-11,16H,3,12-15H2,1-2H3,(H2,29,34)(H,30,32) |
| InChIKey | MMPZBYPLBWNKBL-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.01 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|