C20H24ClF3N6O — CID 88572016
5-chloro-6-ethyl-3-[4-(4-ethylpiperazin-1-yl)-3-(trifluoromethyl)anilino]pyrazine-2-carboxamide (PubChem CID 88572016) has the molecular formula C20H24ClF3N6O and a molecular weight of 456.90 g/mol. Its IUPAC name is 5-chloro-6-ethyl-3-[4-(4-ethylpiperazin-1-yl)-3-(trifluoromethyl)anilino]pyrazine-2-carboxamide.
| Compound Name | 5-chloro-6-ethyl-3-[4-(4-ethylpiperazin-1-yl)-3-(trifluoromethyl)anilino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 88572016 |
| Molecular Formula | C20H24ClF3N6O |
| Molecular Weight | 456.90 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 5-chloro-6-ethyl-3-[4-(4-ethylpiperazin-1-yl)-3-(trifluoromethyl)anilino]pyrazine-2-carboxamide |
| SMILES | CCc1nc(C(N)=O)c(Nc2ccc(N3CCN(CC)CC3)c(C(F)(F)F)c2)nc1Cl |
| InChI | InChI=1S/C20H24ClF3N6O/c1-3-14-17(21)28-19(16(27-14)18(25)31)26-12-5-6-15(13(11-12)20(22,23)24)30-9-7-29(4-2)8-10-30/h5-6,11H,3-4,7-10H2,1-2H3,(H2,25,31)(H,26,28) |
| InChIKey | UQZRAJAYMUQRDD-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.90 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|