C22H29ClN6O3 — CID 88569552
tert-butyl 4-[4-[(3-carbamoyl-6-chloro-5-ethylpyrazin-2-yl)amino]phenyl]piperazine-1-carboxylate (PubChem CID 88569552) has the molecular formula C22H29ClN6O3 and a molecular weight of 460.97 g/mol. Its IUPAC name is tert-butyl 4-[4-[(3-carbamoyl-6-chloro-5-ethylpyrazin-2-yl)amino]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[(3-carbamoyl-6-chloro-5-ethylpyrazin-2-yl)amino]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 88569552 |
| Molecular Formula | C22H29ClN6O3 |
| Molecular Weight | 460.97 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | tert-butyl 4-[4-[(3-carbamoyl-6-chloro-5-ethylpyrazin-2-yl)amino]phenyl]piperazine-1-carboxylate |
| SMILES | CCc1nc(C(N)=O)c(Nc2ccc(N3CCN(C(=O)OC(C)(C)C)CC3)cc2)nc1Cl |
| InChI | InChI=1S/C22H29ClN6O3/c1-5-16-18(23)27-20(17(26-16)19(24)30)25-14-6-8-15(9-7-14)28-10-12-29(13-11-28)21(31)32-22(2,3)4/h6-9H,5,10-13H2,1-4H3,(H2,24,30)(H,25,27) |
| InChIKey | RIOBZZLQPZVCAH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.97 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|