C27H34N8O2 — CID 168769189
3-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-5-(oxan-4-ylamino)-6-pyridin-4-ylpyrazine-2-carboxamide (PubChem CID 168769189) has the molecular formula C27H34N8O2 and a molecular weight of 502.62 g/mol. Its IUPAC name is 3-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-5-(oxan-4-ylamino)-6-pyridin-4-ylpyrazine-2-carboxamide.
| Compound Name | 3-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-5-(oxan-4-ylamino)-6-pyridin-4-ylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 168769189 |
| Molecular Formula | C27H34N8O2 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | 3-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-5-(oxan-4-ylamino)-6-pyridin-4-ylpyrazine-2-carboxamide |
| SMILES | Cc1cc(Nc2nc(NC3CCOCC3)c(-c3ccncc3)nc2C(N)=O)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C27H34N8O2/c1-18-17-21(3-4-22(18)35-13-11-34(2)12-14-35)31-27-24(25(28)36)32-23(19-5-9-29-10-6-19)26(33-27)30-20-7-15-37-16-8-20/h3-6,9-10,17,20H,7-8,11-16H2,1-2H3,(H2,28,36)(H2,30,31,33) |
| InChIKey | CPCMZGZDFCANMV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 121.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|