C26H35N9O2 — CID 168769544
3-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-6-(5-methyl-1H-pyrazol-3-yl)-5-(oxan-4-ylamino)pyrazine-2-carboxamide (PubChem CID 168769544) has the molecular formula C26H35N9O2 and a molecular weight of 505.63 g/mol. Its IUPAC name is 3-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-6-(5-methyl-1H-pyrazol-3-yl)-5-(oxan-4-ylamino)pyrazine-2-carboxamide.
| Compound Name | 3-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-6-(5-methyl-1H-pyrazol-3-yl)-5-(oxan-4-ylamino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 168769544 |
| Molecular Formula | C26H35N9O2 |
| Molecular Weight | 505.63 g/mol |
| Exact Mass | 505.29 |
| IUPAC Name | 3-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-6-(5-methyl-1H-pyrazol-3-yl)-5-(oxan-4-ylamino)pyrazine-2-carboxamide |
| SMILES | Cc1cc(-c2nc(C(N)=O)c(Nc3ccc(N4CCN(C)CC4)c(C)c3)nc2NC2CCOCC2)n[nH]1 |
| InChI | InChI=1S/C26H35N9O2/c1-16-14-19(4-5-21(16)35-10-8-34(3)9-11-35)29-26-23(24(27)36)30-22(20-15-17(2)32-33-20)25(31-26)28-18-6-12-37-13-7-18/h4-5,14-15,18H,6-13H2,1-3H3,(H2,27,36)(H,32,33)(H2,28,29,31) |
| InChIKey | BZMPALHYVIGVKV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 137.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.63 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|