C23H24F2N6O2 — CID 162721135
methyl 3-[[5-fluoro-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]benzoate (PubChem CID 162721135) has the molecular formula C23H24F2N6O2 and a molecular weight of 454.48 g/mol. Its IUPAC name is methyl 3-[[5-fluoro-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]benzoate.
| Compound Name | methyl 3-[[5-fluoro-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 162721135 |
| Molecular Formula | C23H24F2N6O2 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | methyl 3-[[5-fluoro-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]benzoate |
| SMILES | COC(=O)c1cccc(Nc2nc(Nc3ccc(N4CCN(C)CC4)c(F)c3)ncc2F)c1 |
| InChI | InChI=1S/C23H24F2N6O2/c1-30-8-10-31(11-9-30)20-7-6-17(13-18(20)24)28-23-26-14-19(25)21(29-23)27-16-5-3-4-15(12-16)22(32)33-2/h3-7,12-14H,8-11H2,1-2H3,(H2,26,27,28,29) |
| InChIKey | ADTZYWIJTBOYFB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|