C23H31FN6O2 — CID 66873221
methyl 3-[[5-fluoro-2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]cyclopentane-1-carboxylate (PubChem CID 66873221) has the molecular formula C23H31FN6O2 and a molecular weight of 442.54 g/mol. Its IUPAC name is methyl 3-[[5-fluoro-2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]cyclopentane-1-carboxylate.
| Compound Name | methyl 3-[[5-fluoro-2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 66873221 |
| Molecular Formula | C23H31FN6O2 |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | methyl 3-[[5-fluoro-2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]cyclopentane-1-carboxylate |
| SMILES | COC(=O)C1CCC(Nc2nc(Nc3ccc(N4CCN(C)CC4)c(C)c3)ncc2F)C1 |
| InChI | InChI=1S/C23H31FN6O2/c1-15-12-17(6-7-20(15)30-10-8-29(2)9-11-30)27-23-25-14-19(24)21(28-23)26-18-5-4-16(13-18)22(31)32-3/h6-7,12,14,16,18H,4-5,8-11,13H2,1-3H3,(H2,25,26,27,28) |
| InChIKey | CHVHCVZGQYGFAR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|