C22H23F2N7O2 — CID 163214027
4-[[5-fluoro-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-N-hydroxybenzamide (PubChem CID 163214027) has the molecular formula C22H23F2N7O2 and a molecular weight of 455.47 g/mol. Its IUPAC name is 4-[[5-fluoro-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-N-hydroxybenzamide.
| Compound Name | 4-[[5-fluoro-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 163214027 |
| Molecular Formula | C22H23F2N7O2 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 4-[[5-fluoro-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-N-hydroxybenzamide |
| SMILES | CN1CCN(c2ccc(Nc3ncc(F)c(Nc4ccc(C(=O)NO)cc4)n3)cc2F)CC1 |
| InChI | InChI=1S/C22H23F2N7O2/c1-30-8-10-31(11-9-30)19-7-6-16(12-17(19)23)27-22-25-13-18(24)20(28-22)26-15-4-2-14(3-5-15)21(32)29-33/h2-7,12-13,33H,8-11H2,1H3,(H,29,32)(H2,25,26,27,28) |
| InChIKey | OSDYEWMJTQZEJC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 105.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|